C16H18O8 — CID 166850925
(5-formyl-2,3,5-trihydroxycyclohexyl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 166850925) has the molecular formula C16H18O8 and a molecular weight of 338.31 g/mol. Its IUPAC name is (5-formyl-2,3,5-trihydroxycyclohexyl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | (5-formyl-2,3,5-trihydroxycyclohexyl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 166850925 |
| Molecular Formula | C16H18O8 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (5-formyl-2,3,5-trihydroxycyclohexyl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=CC1(O)CC(O)C(O)C(OC(=O)/C=C/c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C16H18O8/c17-8-16(23)6-12(20)15(22)13(7-16)24-14(21)4-2-9-1-3-10(18)11(19)5-9/h1-5,8,12-13,15,18-20,22-23H,6-7H2/b4-2+ |
| InChIKey | ALBXYQWERQZLFZ-DUXPYHPUSA-N |
| XLogP | -0.53 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|