C12H25Cl3O6P2 — CID 10252324
1-[butoxy-(2,2,2-trichloro-1-dimethoxyphosphorylethyl)phosphoryl]oxybutane (PubChem CID 10252324) has the molecular formula C12H25Cl3O6P2 and a molecular weight of 433.63 g/mol. Its IUPAC name is 1-[butoxy-(2,2,2-trichloro-1-dimethoxyphosphorylethyl)phosphoryl]oxybutane.
| Compound Name | 1-[butoxy-(2,2,2-trichloro-1-dimethoxyphosphorylethyl)phosphoryl]oxybutane |
|---|---|
| PubChem CID | 10252324 |
| Molecular Formula | C12H25Cl3O6P2 |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 1-[butoxy-(2,2,2-trichloro-1-dimethoxyphosphorylethyl)phosphoryl]oxybutane |
| SMILES | CCCCOP(=O)(OCCCC)C(C(Cl)(Cl)Cl)P(=O)(OC)OC |
| InChI | InChI=1S/C12H25Cl3O6P2/c1-5-7-9-20-23(17,21-10-8-6-2)11(12(13,14)15)22(16,18-3)19-4/h11H,5-10H2,1-4H3 |
| InChIKey | UALUEVDMWLKXQK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|