C19H43NO6P2 — CID 14512426
1,1-bis(dibutoxyphosphoryl)-N,N-dimethylmethanamine (PubChem CID 14512426) has the molecular formula C19H43NO6P2 and a molecular weight of 443.50 g/mol. Its IUPAC name is 1,1-bis(dibutoxyphosphoryl)-N,N-dimethylmethanamine.
| Compound Name | 1,1-bis(dibutoxyphosphoryl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 14512426 |
| Molecular Formula | C19H43NO6P2 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 1,1-bis(dibutoxyphosphoryl)-N,N-dimethylmethanamine |
| SMILES | CCCCOP(=O)(OCCCC)C(N(C)C)P(=O)(OCCCC)OCCCC |
| InChI | InChI=1S/C19H43NO6P2/c1-7-11-15-23-27(21,24-16-12-8-2)19(20(5)6)28(22,25-17-13-9-3)26-18-14-10-4/h19H,7-18H2,1-6H3 |
| InChIKey | NNUYAYUGTPYHRP-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|