C27H26NO6P — CID 102523285
[(2S,3S)-4-hydroxy-3-(3-perylen-3-ylpropanoylamino)butan-2-yl] dihydrogen phosphate (PubChem CID 102523285) has the molecular formula C27H26NO6P and a molecular weight of 491.48 g/mol. Its IUPAC name is [(2S,3S)-4-hydroxy-3-(3-perylen-3-ylpropanoylamino)butan-2-yl] dihydrogen phosphate.
| Compound Name | [(2S,3S)-4-hydroxy-3-(3-perylen-3-ylpropanoylamino)butan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 102523285 |
| Molecular Formula | C27H26NO6P |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | [(2S,3S)-4-hydroxy-3-(3-perylen-3-ylpropanoylamino)butan-2-yl] dihydrogen phosphate |
| SMILES | C[C@H](OP(=O)(O)O)[C@H](CO)NC(=O)CCc1ccc2c3cccc4cccc(c5cccc1c52)c43 |
| InChI | InChI=1S/C27H26NO6P/c1-16(34-35(31,32)33)24(15-29)28-25(30)14-12-17-11-13-23-21-9-3-6-18-5-2-8-20(26(18)21)22-10-4-7-19(17)27(22)23/h2-11,13,16,24,29H,12,14-15H2,1H3,(H,28,30)(H2,31,32,33)/t16-,24-/m0/s1 |
| InChIKey | PZIIBEKYMGHFBT-FYSMJZIKSA-N |
| XLogP | 4.64 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|