C28H21NO4 — CID 71374516
(2,5-dioxopyrrolidin-1-yl) 4-perylen-3-ylbutanoate (PubChem CID 71374516) has the molecular formula C28H21NO4 and a molecular weight of 435.48 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-perylen-3-ylbutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-perylen-3-ylbutanoate |
|---|---|
| PubChem CID | 71374516 |
| Molecular Formula | C28H21NO4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-perylen-3-ylbutanoate |
| SMILES | O=C(CCCc1ccc2c3cccc4cccc(c5cccc1c52)c43)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C28H21NO4/c30-24-15-16-25(31)29(24)33-26(32)12-3-5-17-13-14-23-21-10-2-7-18-6-1-9-20(27(18)21)22-11-4-8-19(17)28(22)23/h1-2,4,6-11,13-14H,3,5,12,15-16H2 |
| InChIKey | BLNPWNQHMQAQLB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|