C13H15NO4 — CID 154973989
(2,5-dioxopyrrolidin-1-yl) 4-cyclopenta-1,4-dien-1-ylbutanoate (PubChem CID 154973989) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-cyclopenta-1,4-dien-1-ylbutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-cyclopenta-1,4-dien-1-ylbutanoate |
|---|---|
| PubChem CID | 154973989 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-cyclopenta-1,4-dien-1-ylbutanoate |
| SMILES | O=C(CCCC1=CCC=C1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C13H15NO4/c15-11-8-9-12(16)14(11)18-13(17)7-3-6-10-4-1-2-5-10/h1,4-5H,2-3,6-9H2 |
| InChIKey | RUXWBXSPJXDTMA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|