C14H19NO2 — CID 102523452
[(2S,3aR,5R)-2-phenyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-5-yl]methanol (PubChem CID 102523452) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is [(2S,3aR,5R)-2-phenyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-5-yl]methanol.
| Compound Name | [(2S,3aR,5R)-2-phenyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-5-yl]methanol |
|---|---|
| PubChem CID | 102523452 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | [(2S,3aR,5R)-2-phenyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-5-yl]methanol |
| SMILES | OC[C@@H]1CCN2O[C@H](c3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C14H19NO2/c16-10-11-6-7-15-13(8-11)9-14(17-15)12-4-2-1-3-5-12/h1-5,11,13-14,16H,6-10H2/t11-,13-,14+/m1/s1 |
| InChIKey | DSDOOVWFDDRRGF-BNOWGMLFSA-N |
| XLogP | 2.14 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |