C24H28N2 — CID 102523840
(Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)-N-[(Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]ethanimine (PubChem CID 102523840) has the molecular formula C24H28N2 and a molecular weight of 344.50 g/mol. Its IUPAC name is (Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)-N-[(Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]ethanimine.
| Compound Name | (Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)-N-[(Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]ethanimine |
|---|---|
| PubChem CID | 102523840 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | (Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)-N-[(Z)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]ethanimine |
| SMILES | C/C(=N/N=C(/C)c1ccc2c(c1)CCCC2)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C24H28N2/c1-17(21-13-11-19-7-3-5-9-23(19)15-21)25-26-18(2)22-14-12-20-8-4-6-10-24(20)16-22/h11-16H,3-10H2,1-2H3/b25-17-,26-18- |
| InChIKey | WHRKRZFRCDLKOW-MFYXSQMNSA-N |
| XLogP | 5.68 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|