C15H12N4O2S2 — CID 102524140
ethyl 12-methyl-4-thiophen-2-yl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate (PubChem CID 102524140) has the molecular formula C15H12N4O2S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is ethyl 12-methyl-4-thiophen-2-yl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate.
| Compound Name | ethyl 12-methyl-4-thiophen-2-yl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate |
|---|---|
| PubChem CID | 102524140 |
| Molecular Formula | C15H12N4O2S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | ethyl 12-methyl-4-thiophen-2-yl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate |
| SMILES | CCOC(=O)c1sc2ncn3nc(-c4cccs4)nc3c2c1C |
| InChI | InChI=1S/C15H12N4O2S2/c1-3-21-15(20)11-8(2)10-13-17-12(9-5-4-6-22-9)18-19(13)7-16-14(10)23-11/h4-7H,3H2,1-2H3 |
| InChIKey | MTXJMQFAPMOEFE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |