C38H26N2O3 — CID 102524659
(E)-2-cyano-3-[5-[7-(N-naphthalen-1-ylanilino)-9,10-dihydrophenanthren-2-yl]furan-2-yl]prop-2-enoic acid (PubChem CID 102524659) has the molecular formula C38H26N2O3 and a molecular weight of 558.64 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[7-(N-naphthalen-1-ylanilino)-9,10-dihydrophenanthren-2-yl]furan-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[7-(N-naphthalen-1-ylanilino)-9,10-dihydrophenanthren-2-yl]furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102524659 |
| Molecular Formula | C38H26N2O3 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | (E)-2-cyano-3-[5-[7-(N-naphthalen-1-ylanilino)-9,10-dihydrophenanthren-2-yl]furan-2-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ccc3c(c2)CCc2cc(N(c4ccccc4)c4cccc5ccccc45)ccc2-3)o1)C(=O)O |
| InChI | InChI=1S/C38H26N2O3/c39-24-29(38(41)42)23-32-17-20-37(43-32)28-15-18-33-26(21-28)13-14-27-22-31(16-19-34(27)33)40(30-9-2-1-3-10-30)36-12-6-8-25-7-4-5-11-35(25)36/h1-12,15-23H,13-14H2,(H,41,42)/b29-23+ |
| InChIKey | HHZUHUKWKGBCAF-BYNJWEBRSA-N |
| XLogP | 9.33 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|