C18H27N3O — CID 102525382
N-[(1R,2R)-2-[[(2S)-pyrrolidin-2-yl]methylamino]cyclohexyl]benzamide (PubChem CID 102525382) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is N-[(1R,2R)-2-[[(2S)-pyrrolidin-2-yl]methylamino]cyclohexyl]benzamide.
| Compound Name | N-[(1R,2R)-2-[[(2S)-pyrrolidin-2-yl]methylamino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 102525382 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | N-[(1R,2R)-2-[[(2S)-pyrrolidin-2-yl]methylamino]cyclohexyl]benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1NC[C@@H]1CCCN1)c1ccccc1 |
| InChI | InChI=1S/C18H27N3O/c22-18(14-7-2-1-3-8-14)21-17-11-5-4-10-16(17)20-13-15-9-6-12-19-15/h1-3,7-8,15-17,19-20H,4-6,9-13H2,(H,21,22)/t15-,16+,17+/m0/s1 |
| InChIKey | VUPABCPEQGJCNX-GVDBMIGSSA-N |
| XLogP | 2.07 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |