C18H20N3O2+ — CID 102525475
N-[(2S)-2-hydroxy-2-phenylethyl]-2-(3-methylbenzimidazol-3-ium-1-yl)acetamide (PubChem CID 102525475) has the molecular formula C18H20N3O2+ and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-2-phenylethyl]-2-(3-methylbenzimidazol-3-ium-1-yl)acetamide.
| Compound Name | N-[(2S)-2-hydroxy-2-phenylethyl]-2-(3-methylbenzimidazol-3-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 102525475 |
| Molecular Formula | C18H20N3O2+ |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | N-[(2S)-2-hydroxy-2-phenylethyl]-2-(3-methylbenzimidazol-3-ium-1-yl)acetamide |
| SMILES | C[n+]1cn(CC(=O)NC[C@@H](O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H19N3O2/c1-20-13-21(16-10-6-5-9-15(16)20)12-18(23)19-11-17(22)14-7-3-2-4-8-14/h2-10,13,17,22H,11-12H2,1H3/p+1/t17-/m1/s1 |
| InChIKey | VBXRZRHSVOEJDY-QGZVFWFLSA-O |
| XLogP | 1.32 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|