C15H20ClN3O4 — CID 71508245
methyl (2S,3R)-3-hydroxy-2-[[2-(3-methylbenzimidazol-3-ium-1-yl)acetyl]amino]butanoate chloride (PubChem CID 71508245) has the molecular formula C15H20ClN3O4 and a molecular weight of 341.80 g/mol. Its IUPAC name is methyl (2S,3R)-3-hydroxy-2-[[2-(3-methylbenzimidazol-3-ium-1-yl)acetyl]amino]butanoate chloride.
| Compound Name | methyl (2S,3R)-3-hydroxy-2-[[2-(3-methylbenzimidazol-3-ium-1-yl)acetyl]amino]butanoate chloride |
|---|---|
| PubChem CID | 71508245 |
| Molecular Formula | C15H20ClN3O4 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | methyl (2S,3R)-3-hydroxy-2-[[2-(3-methylbenzimidazol-3-ium-1-yl)acetyl]amino]butanoate chloride |
| SMILES | COC(=O)[C@@H](NC(=O)Cn1c[n+](C)c2ccccc21)[C@@H](C)O.[Cl-] |
| InChI | InChI=1S/C15H19N3O4.ClH/c1-10(19)14(15(21)22-3)16-13(20)8-18-9-17(2)11-6-4-5-7-12(11)18;/h4-7,9-10,14,19H,8H2,1-3H3;1H/t10-,14+;/m1./s1 |
| InChIKey | HVMUNARUQCIDNN-LOSLGVLSSA-N |
| XLogP | -3.49 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|