C15H7F5N2O — CID 102525584
2-(2-methylphenyl)-5-(2,3,4,5,6-pentafluorophenyl)-1,3,4-oxadiazole (PubChem CID 102525584) has the molecular formula C15H7F5N2O and a molecular weight of 326.22 g/mol. Its IUPAC name is 2-(2-methylphenyl)-5-(2,3,4,5,6-pentafluorophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-methylphenyl)-5-(2,3,4,5,6-pentafluorophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 102525584 |
| Molecular Formula | C15H7F5N2O |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-(2-methylphenyl)-5-(2,3,4,5,6-pentafluorophenyl)-1,3,4-oxadiazole |
| SMILES | Cc1ccccc1-c1nnc(-c2c(F)c(F)c(F)c(F)c2F)o1 |
| InChI | InChI=1S/C15H7F5N2O/c1-6-4-2-3-5-7(6)14-21-22-15(23-14)8-9(16)11(18)13(20)12(19)10(8)17/h2-5H,1H3 |
| InChIKey | ZJVYEPSJVQLSHP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|