C16H10F2N2O3 — CID 135391526
[2-[5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-yl]phenyl] acetate (PubChem CID 135391526) has the molecular formula C16H10F2N2O3 and a molecular weight of 316.26 g/mol. Its IUPAC name is [2-[5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-yl]phenyl] acetate.
| Compound Name | [2-[5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 135391526 |
| Molecular Formula | C16H10F2N2O3 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | [2-[5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1-c1nnc(-c2c(F)cccc2F)o1 |
| InChI | InChI=1S/C16H10F2N2O3/c1-9(21)22-13-8-3-2-5-10(13)15-19-20-16(23-15)14-11(17)6-4-7-12(14)18/h2-8H,1H3 |
| InChIKey | KCNODYKMAXAXMY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|