C17H12F2N2OS — CID 126720554
2-(2,6-difluorophenyl)-5-(2-prop-2-enylsulfanylphenyl)-1,3,4-oxadiazole (PubChem CID 126720554) has the molecular formula C17H12F2N2OS and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-5-(2-prop-2-enylsulfanylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2,6-difluorophenyl)-5-(2-prop-2-enylsulfanylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 126720554 |
| Molecular Formula | C17H12F2N2OS |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-(2,6-difluorophenyl)-5-(2-prop-2-enylsulfanylphenyl)-1,3,4-oxadiazole |
| SMILES | C=CCSc1ccccc1-c1nnc(-c2c(F)cccc2F)o1 |
| InChI | InChI=1S/C17H12F2N2OS/c1-2-10-23-14-9-4-3-6-11(14)16-20-21-17(22-16)15-12(18)7-5-8-13(15)19/h2-9H,1,10H2 |
| InChIKey | JAEGGGOCBFTQOM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|