C12H14OS2 — CID 70364584
2,3-bis(prop-2-enylsulfanyl)phenol (PubChem CID 70364584) has the molecular formula C12H14OS2 and a molecular weight of 238.38 g/mol. Its IUPAC name is 2,3-bis(prop-2-enylsulfanyl)phenol.
| Compound Name | 2,3-bis(prop-2-enylsulfanyl)phenol |
|---|---|
| PubChem CID | 70364584 |
| Molecular Formula | C12H14OS2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2,3-bis(prop-2-enylsulfanyl)phenol |
| SMILES | C=CCSc1cccc(O)c1SCC=C |
| InChI | InChI=1S/C12H14OS2/c1-3-8-14-11-7-5-6-10(13)12(11)15-9-4-2/h3-7,13H,1-2,8-9H2 |
| InChIKey | DEFBJFGQRQHHIK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|