C16H15Cl2NS — CID 63448914
N-[(2,6-dichlorophenyl)methyl]-2-prop-2-enylsulfanylaniline (PubChem CID 63448914) has the molecular formula C16H15Cl2NS and a molecular weight of 324.28 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-2-prop-2-enylsulfanylaniline.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-2-prop-2-enylsulfanylaniline |
|---|---|
| PubChem CID | 63448914 |
| Molecular Formula | C16H15Cl2NS |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-2-prop-2-enylsulfanylaniline |
| SMILES | C=CCSc1ccccc1NCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H15Cl2NS/c1-2-10-20-16-9-4-3-8-15(16)19-11-12-13(17)6-5-7-14(12)18/h2-9,19H,1,10-11H2 |
| InChIKey | MWACONFHVUQQSI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|