C16H14F3NS — CID 63051218
2-prop-2-enylsulfanyl-N-[(3,4,5-trifluorophenyl)methyl]aniline (PubChem CID 63051218) has the molecular formula C16H14F3NS and a molecular weight of 309.36 g/mol. Its IUPAC name is 2-prop-2-enylsulfanyl-N-[(3,4,5-trifluorophenyl)methyl]aniline.
| Compound Name | 2-prop-2-enylsulfanyl-N-[(3,4,5-trifluorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 63051218 |
| Molecular Formula | C16H14F3NS |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-prop-2-enylsulfanyl-N-[(3,4,5-trifluorophenyl)methyl]aniline |
| SMILES | C=CCSc1ccccc1NCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C16H14F3NS/c1-2-7-21-15-6-4-3-5-14(15)20-10-11-8-12(17)16(19)13(18)9-11/h2-6,8-9,20H,1,7,10H2 |
| InChIKey | DLPFOULQISYDPK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|