C15H23NS — CID 63448960
N-(2-ethylbutyl)-2-prop-2-enylsulfanylaniline (PubChem CID 63448960) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is N-(2-ethylbutyl)-2-prop-2-enylsulfanylaniline.
| Compound Name | N-(2-ethylbutyl)-2-prop-2-enylsulfanylaniline |
|---|---|
| PubChem CID | 63448960 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | N-(2-ethylbutyl)-2-prop-2-enylsulfanylaniline |
| SMILES | C=CCSc1ccccc1NCC(CC)CC |
| InChI | InChI=1S/C15H23NS/c1-4-11-17-15-10-8-7-9-14(15)16-12-13(5-2)6-3/h4,7-10,13,16H,1,5-6,11-12H2,2-3H3 |
| InChIKey | SONNYUNTWFQARR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|