C18H20FNS — CID 63449265
N-[1-(4-fluorophenyl)propyl]-2-prop-2-enylsulfanylaniline (PubChem CID 63449265) has the molecular formula C18H20FNS and a molecular weight of 301.43 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)propyl]-2-prop-2-enylsulfanylaniline.
| Compound Name | N-[1-(4-fluorophenyl)propyl]-2-prop-2-enylsulfanylaniline |
|---|---|
| PubChem CID | 63449265 |
| Molecular Formula | C18H20FNS |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-[1-(4-fluorophenyl)propyl]-2-prop-2-enylsulfanylaniline |
| SMILES | C=CCSc1ccccc1NC(CC)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FNS/c1-3-13-21-18-8-6-5-7-17(18)20-16(4-2)14-9-11-15(19)12-10-14/h3,5-12,16,20H,1,4,13H2,2H3 |
| InChIKey | AJUHELKNLNABJB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|