C19H23NS — CID 79008915
N-(1-phenylbutan-2-yl)-2-prop-2-enylsulfanylaniline (PubChem CID 79008915) has the molecular formula C19H23NS and a molecular weight of 297.47 g/mol. Its IUPAC name is N-(1-phenylbutan-2-yl)-2-prop-2-enylsulfanylaniline.
| Compound Name | N-(1-phenylbutan-2-yl)-2-prop-2-enylsulfanylaniline |
|---|---|
| PubChem CID | 79008915 |
| Molecular Formula | C19H23NS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-(1-phenylbutan-2-yl)-2-prop-2-enylsulfanylaniline |
| SMILES | C=CCSc1ccccc1NC(CC)Cc1ccccc1 |
| InChI | InChI=1S/C19H23NS/c1-3-14-21-19-13-9-8-12-18(19)20-17(4-2)15-16-10-6-5-7-11-16/h3,5-13,17,20H,1,4,14-15H2,2H3 |
| InChIKey | OCJGFNSCANUSRK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|