C16H23NS — CID 55191581
N-(1-cyclopentylethyl)-2-prop-2-enylsulfanylaniline (PubChem CID 55191581) has the molecular formula C16H23NS and a molecular weight of 261.43 g/mol. Its IUPAC name is N-(1-cyclopentylethyl)-2-prop-2-enylsulfanylaniline.
| Compound Name | N-(1-cyclopentylethyl)-2-prop-2-enylsulfanylaniline |
|---|---|
| PubChem CID | 55191581 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | N-(1-cyclopentylethyl)-2-prop-2-enylsulfanylaniline |
| SMILES | C=CCSc1ccccc1NC(C)C1CCCC1 |
| InChI | InChI=1S/C16H23NS/c1-3-12-18-16-11-7-6-10-15(16)17-13(2)14-8-4-5-9-14/h3,6-7,10-11,13-14,17H,1,4-5,8-9,12H2,2H3 |
| InChIKey | BNPSTECVMXLIDM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|