C21H14F2N2O4S — CID 137346309
[2-[5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 137346309) has the molecular formula C21H14F2N2O4S and a molecular weight of 428.42 g/mol. Its IUPAC name is [2-[5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-yl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-yl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 137346309 |
| Molecular Formula | C21H14F2N2O4S |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | [2-[5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccc2-c2nnc(-c3c(F)cccc3F)o2)cc1 |
| InChI | InChI=1S/C21H14F2N2O4S/c1-13-9-11-14(12-10-13)30(26,27)29-18-8-3-2-5-15(18)20-24-25-21(28-20)19-16(22)6-4-7-17(19)23/h2-12H,1H3 |
| InChIKey | OJTYPCXYDNSSAC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|