C20H18N2O3 — CID 10404642
2,5-bis(2-prop-2-enoxyphenyl)-1,3,4-oxadiazole (PubChem CID 10404642) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2,5-bis(2-prop-2-enoxyphenyl)-1,3,4-oxadiazole.
| Compound Name | 2,5-bis(2-prop-2-enoxyphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 10404642 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2,5-bis(2-prop-2-enoxyphenyl)-1,3,4-oxadiazole |
| SMILES | C=CCOc1ccccc1-c1nnc(-c2ccccc2OCC=C)o1 |
| InChI | InChI=1S/C20H18N2O3/c1-3-13-23-17-11-7-5-9-15(17)19-21-22-20(25-19)16-10-6-8-12-18(16)24-14-4-2/h3-12H,1-2,13-14H2 |
| InChIKey | ULTNYBCIYZVQJO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|