C11H12N2O2S — CID 82159229
[5-(2-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]methanethiol (PubChem CID 82159229) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is [5-(2-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]methanethiol.
| Compound Name | [5-(2-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]methanethiol |
|---|---|
| PubChem CID | 82159229 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | [5-(2-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]methanethiol |
| SMILES | CCOc1ccccc1-c1nnc(CS)o1 |
| InChI | InChI=1S/C11H12N2O2S/c1-2-14-9-6-4-3-5-8(9)11-13-12-10(7-16)15-11/h3-6,16H,2,7H2,1H3 |
| InChIKey | IFJAIZXMVJAKIN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 48.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|