C18H19N3O4 — CID 157018633
N-(3,5-dimethoxyphenyl)-5-(2-ethoxyphenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 157018633) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-5-(2-ethoxyphenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-5-(2-ethoxyphenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 157018633 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-5-(2-ethoxyphenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCOc1ccccc1-c1nnc(Nc2cc(OC)cc(OC)c2)o1 |
| InChI | InChI=1S/C18H19N3O4/c1-4-24-16-8-6-5-7-15(16)17-20-21-18(25-17)19-12-9-13(22-2)11-14(10-12)23-3/h5-11H,4H2,1-3H3,(H,19,21) |
| InChIKey | VJLFPXMVACOZAB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |