C26H23NO6 — CID 98476312
N-[2-(2-ethoxyphenyl)-4-oxochromen-7-yl]-3,5-dimethoxybenzamide (PubChem CID 98476312) has the molecular formula C26H23NO6 and a molecular weight of 445.47 g/mol. Its IUPAC name is N-[2-(2-ethoxyphenyl)-4-oxochromen-7-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(2-ethoxyphenyl)-4-oxochromen-7-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 98476312 |
| Molecular Formula | C26H23NO6 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-[2-(2-ethoxyphenyl)-4-oxochromen-7-yl]-3,5-dimethoxybenzamide |
| SMILES | CCOc1ccccc1-c1cc(=O)c2ccc(NC(=O)c3cc(OC)cc(OC)c3)cc2o1 |
| InChI | InChI=1S/C26H23NO6/c1-4-32-23-8-6-5-7-21(23)25-15-22(28)20-10-9-17(13-24(20)33-25)27-26(29)16-11-18(30-2)14-19(12-16)31-3/h5-15H,4H2,1-3H3,(H,27,29) |
| InChIKey | VMFMFZLMLUVJEK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |