C25H21NO5 — CID 98476056
N-[2-(2-ethoxyphenyl)-4-oxochromen-7-yl]-4-methoxybenzamide (PubChem CID 98476056) has the molecular formula C25H21NO5 and a molecular weight of 415.45 g/mol. Its IUPAC name is N-[2-(2-ethoxyphenyl)-4-oxochromen-7-yl]-4-methoxybenzamide.
| Compound Name | N-[2-(2-ethoxyphenyl)-4-oxochromen-7-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 98476056 |
| Molecular Formula | C25H21NO5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[2-(2-ethoxyphenyl)-4-oxochromen-7-yl]-4-methoxybenzamide |
| SMILES | CCOc1ccccc1-c1cc(=O)c2ccc(NC(=O)c3ccc(OC)cc3)cc2o1 |
| InChI | InChI=1S/C25H21NO5/c1-3-30-22-7-5-4-6-20(22)24-15-21(27)19-13-10-17(14-23(19)31-24)26-25(28)16-8-11-18(29-2)12-9-16/h4-15H,3H2,1-2H3,(H,26,28) |
| InChIKey | DDJSTCFLBFIRKG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |