C24H17NO6 — CID 98476256
N-[2-(2-methoxyphenyl)-4-oxochromen-7-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 98476256) has the molecular formula C24H17NO6 and a molecular weight of 415.40 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)-4-oxochromen-7-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-(2-methoxyphenyl)-4-oxochromen-7-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 98476256 |
| Molecular Formula | C24H17NO6 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[2-(2-methoxyphenyl)-4-oxochromen-7-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1ccccc1-c1cc(=O)c2ccc(NC(=O)c3ccc4c(c3)OCO4)cc2o1 |
| InChI | InChI=1S/C24H17NO6/c1-28-19-5-3-2-4-17(19)22-12-18(26)16-8-7-15(11-21(16)31-22)25-24(27)14-6-9-20-23(10-14)30-13-29-20/h2-12H,13H2,1H3,(H,25,27) |
| InChIKey | YOJNKGJZZCOOIJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |