C24H19NO5 — CID 18568778
3,5-dimethoxy-N-(4-oxo-2-phenylchromen-6-yl)benzamide (PubChem CID 18568778) has the molecular formula C24H19NO5 and a molecular weight of 401.42 g/mol. Its IUPAC name is 3,5-dimethoxy-N-(4-oxo-2-phenylchromen-6-yl)benzamide.
| Compound Name | 3,5-dimethoxy-N-(4-oxo-2-phenylchromen-6-yl)benzamide |
|---|---|
| PubChem CID | 18568778 |
| Molecular Formula | C24H19NO5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 3,5-dimethoxy-N-(4-oxo-2-phenylchromen-6-yl)benzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc3oc(-c4ccccc4)cc(=O)c3c2)c1 |
| InChI | InChI=1S/C24H19NO5/c1-28-18-10-16(11-19(13-18)29-2)24(27)25-17-8-9-22-20(12-17)21(26)14-23(30-22)15-6-4-3-5-7-15/h3-14H,1-2H3,(H,25,27) |
| InChIKey | HRUURCGZWAMXPQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |