C14H12N2O4 — CID 12535849
6-oxo-2-(2-prop-2-enoxyphenyl)-1H-pyrimidine-5-carboxylic acid (PubChem CID 12535849) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 6-oxo-2-(2-prop-2-enoxyphenyl)-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 6-oxo-2-(2-prop-2-enoxyphenyl)-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 12535849 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 6-oxo-2-(2-prop-2-enoxyphenyl)-1H-pyrimidine-5-carboxylic acid |
| SMILES | C=CCOc1ccccc1-c1ncc(C(=O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C14H12N2O4/c1-2-7-20-11-6-4-3-5-9(11)12-15-8-10(14(18)19)13(17)16-12/h2-6,8H,1,7H2,(H,18,19)(H,15,16,17) |
| InChIKey | DLUHBQNBHLIWLV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|