C34H24S6 — CID 102525818
2-(1,3-dithiol-2-ylidene)-4,5-bis(9H-fluoren-2-ylmethylsulfanyl)-1,3-dithiole (PubChem CID 102525818) has the molecular formula C34H24S6 and a molecular weight of 624.97 g/mol. Its IUPAC name is 2-(1,3-dithiol-2-ylidene)-4,5-bis(9H-fluoren-2-ylmethylsulfanyl)-1,3-dithiole.
| Compound Name | 2-(1,3-dithiol-2-ylidene)-4,5-bis(9H-fluoren-2-ylmethylsulfanyl)-1,3-dithiole |
|---|---|
| PubChem CID | 102525818 |
| Molecular Formula | C34H24S6 |
| Molecular Weight | 624.97 g/mol |
| Exact Mass | 624.02 |
| IUPAC Name | 2-(1,3-dithiol-2-ylidene)-4,5-bis(9H-fluoren-2-ylmethylsulfanyl)-1,3-dithiole |
| SMILES | C1=CSC(=C2SC(SCc3ccc4c(c3)Cc3ccccc3-4)=C(SCc3ccc4c(c3)Cc3ccccc3-4)S2)S1 |
| InChI | InChI=1S/C34H24S6/c1-3-7-27-23(5-1)17-25-15-21(9-11-29(25)27)19-37-32-33(40-34(39-32)31-35-13-14-36-31)38-20-22-10-12-30-26(16-22)18-24-6-2-4-8-28(24)30/h1-16H,17-20H2 |
| InChIKey | OUNCQYZGRYRYHX-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.97 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |