C31H34N2O — CID 102525876
(4S,4aR,8aS)-4-[(4-methylanilino)-(4-methylphenyl)methyl]-2-(4-methylphenyl)-1,4,4a,7,8,8a-hexahydroisoquinolin-3-one (PubChem CID 102525876) has the molecular formula C31H34N2O and a molecular weight of 450.63 g/mol. Its IUPAC name is (4S,4aR,8aS)-4-[(4-methylanilino)-(4-methylphenyl)methyl]-2-(4-methylphenyl)-1,4,4a,7,8,8a-hexahydroisoquinolin-3-one.
| Compound Name | (4S,4aR,8aS)-4-[(4-methylanilino)-(4-methylphenyl)methyl]-2-(4-methylphenyl)-1,4,4a,7,8,8a-hexahydroisoquinolin-3-one |
|---|---|
| PubChem CID | 102525876 |
| Molecular Formula | C31H34N2O |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | (4S,4aR,8aS)-4-[(4-methylanilino)-(4-methylphenyl)methyl]-2-(4-methylphenyl)-1,4,4a,7,8,8a-hexahydroisoquinolin-3-one |
| SMILES | Cc1ccc(NC(c2ccc(C)cc2)[C@H]2C(=O)N(c3ccc(C)cc3)C[C@H]3CCC=C[C@H]32)cc1 |
| InChI | InChI=1S/C31H34N2O/c1-21-8-14-24(15-9-21)30(32-26-16-10-22(2)11-17-26)29-28-7-5-4-6-25(28)20-33(31(29)34)27-18-12-23(3)13-19-27/h5,7-19,25,28-30,32H,4,6,20H2,1-3H3/t25-,28-,29+,30?/m1/s1 |
| InChIKey | KVKZNWAIONMFHW-MJDVSBIHSA-N |
| XLogP | 7.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|