C78H126O12S2 — CID 102526088
2-methyl-3-[2-[2-methyl-5-(3,4,5-tris-decoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-[3,4,5-tris[2-[2-(2-methoxyethoxy)ethoxy]ethyl]phenyl]thiophene (PubChem CID 102526088) has the molecular formula C78H126O12S2 and a molecular weight of 1319.99 g/mol. Its IUPAC name is 2-methyl-3-[2-[2-methyl-5-(3,4,5-tris-decoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-[3,4,5-tris[2-[2-(2-methoxyethoxy)ethoxy]ethyl]phenyl]thiophene.
| Compound Name | 2-methyl-3-[2-[2-methyl-5-(3,4,5-tris-decoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-[3,4,5-tris[2-[2-(2-methoxyethoxy)ethoxy]ethyl]phenyl]thiophene |
|---|---|
| PubChem CID | 102526088 |
| Molecular Formula | C78H126O12S2 |
| Molecular Weight | 1319.99 g/mol |
| Exact Mass | 1318.87 |
| IUPAC Name | 2-methyl-3-[2-[2-methyl-5-(3,4,5-tris-decoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-[3,4,5-tris[2-[2-(2-methoxyethoxy)ethoxy]ethyl]phenyl]thiophene |
| SMILES | CCCCCCCCCCOc1cc(-c2cc(C3=C(c4cc(-c5cc(CCOCCOCCOC)c(CCOCCOCCOC)c(CCOCCOCCOC)c5)sc4C)CCC3)c(C)s2)cc(OCCCCCCCCCC)c1OCCCCCCCCCC |
| InChI | InChI=1S/C78H126O12S2/c1-9-12-15-18-21-24-27-30-39-88-74-59-68(60-75(89-40-31-28-25-22-19-16-13-10-2)78(74)90-41-32-29-26-23-20-17-14-11-3)77-62-73(64(5)92-77)71-35-33-34-70(71)72-61-76(91-63(72)4)67-57-65(36-42-82-51-54-85-48-45-79-6)69(38-44-84-53-56-87-50-47-81-8)66(58-67)37-43-83-52-55-86-49-46-80-7/h57-62H,9-56H2,1-8H3 |
| InChIKey | YIPWWVJKFPAUMT-UHFFFAOYSA-N |
| XLogP | 20.08 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 61 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1319.99 |
| LogP ≤ 5 | 20.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|