C30H48O5S — CID 59287922
5-(2,5-dihexoxy-4-methylphenyl)-3-[2-(2-methoxyethoxy)ethoxymethyl]-2-methylthiophene (PubChem CID 59287922) has the molecular formula C30H48O5S and a molecular weight of 520.78 g/mol. Its IUPAC name is 5-(2,5-dihexoxy-4-methylphenyl)-3-[2-(2-methoxyethoxy)ethoxymethyl]-2-methylthiophene.
| Compound Name | 5-(2,5-dihexoxy-4-methylphenyl)-3-[2-(2-methoxyethoxy)ethoxymethyl]-2-methylthiophene |
|---|---|
| PubChem CID | 59287922 |
| Molecular Formula | C30H48O5S |
| Molecular Weight | 520.78 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | 5-(2,5-dihexoxy-4-methylphenyl)-3-[2-(2-methoxyethoxy)ethoxymethyl]-2-methylthiophene |
| SMILES | CCCCCCOc1cc(-c2cc(COCCOCCOC)c(C)s2)c(OCCCCCC)cc1C |
| InChI | InChI=1S/C30H48O5S/c1-6-8-10-12-14-34-28-22-27(29(20-24(28)3)35-15-13-11-9-7-2)30-21-26(25(4)36-30)23-33-19-18-32-17-16-31-5/h20-22H,6-19,23H2,1-5H3 |
| InChIKey | MEQXONYLJCTEND-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.78 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|