C25H19ClO — CID 102527134
(4E,6E)-1-(4-chlorophenyl)-3,7-diphenylhepta-4,6-dien-1-yn-3-ol (PubChem CID 102527134) has the molecular formula C25H19ClO and a molecular weight of 370.88 g/mol. Its IUPAC name is (4E,6E)-1-(4-chlorophenyl)-3,7-diphenylhepta-4,6-dien-1-yn-3-ol.
| Compound Name | (4E,6E)-1-(4-chlorophenyl)-3,7-diphenylhepta-4,6-dien-1-yn-3-ol |
|---|---|
| PubChem CID | 102527134 |
| Molecular Formula | C25H19ClO |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (4E,6E)-1-(4-chlorophenyl)-3,7-diphenylhepta-4,6-dien-1-yn-3-ol |
| SMILES | OC(C#Cc1ccc(Cl)cc1)(/C=C/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H19ClO/c26-24-16-14-22(15-17-24)18-20-25(27,23-12-5-2-6-13-23)19-8-7-11-21-9-3-1-4-10-21/h1-17,19,27H/b11-7+,19-8+ |
| InChIKey | MKNQMWXAKLYPFK-KMCODNHSSA-N |
| XLogP | 5.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|