C24H25ClN2O4 — CID 10252718
7-[(5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)oxy]-7-oxoheptanoic acid;hydrochloride (PubChem CID 10252718) has the molecular formula C24H25ClN2O4 and a molecular weight of 440.93 g/mol. Its IUPAC name is 7-[(5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)oxy]-7-oxoheptanoic acid;hydrochloride.
| Compound Name | 7-[(5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)oxy]-7-oxoheptanoic acid;hydrochloride |
|---|---|
| PubChem CID | 10252718 |
| Molecular Formula | C24H25ClN2O4 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 7-[(5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)oxy]-7-oxoheptanoic acid;hydrochloride |
| SMILES | Cc1c2ccncc2c(C)c2c1[nH]c1ccc(OC(=O)CCCCCC(=O)O)cc12.Cl |
| InChI | InChI=1S/C24H24N2O4.ClH/c1-14-19-13-25-11-10-17(19)15(2)24-23(14)18-12-16(8-9-20(18)26-24)30-22(29)7-5-3-4-6-21(27)28;/h8-13,26H,3-7H2,1-2H3,(H,27,28);1H |
| InChIKey | FMSRAYJQBKEFBI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|