C8H14Br2O — CID 102528583
trans-(1R,2S)-1-(dibromomethyl)-2-methylcyclohexan-1-ol (PubChem CID 102528583) has the molecular formula C8H14Br2O and a molecular weight of 286.01 g/mol. Its IUPAC name is trans-(1R,2S)-1-(dibromomethyl)-2-methylcyclohexan-1-ol.
| Compound Name | trans-(1R,2S)-1-(dibromomethyl)-2-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 102528583 |
| Molecular Formula | C8H14Br2O |
| Molecular Weight | 286.01 g/mol |
| Exact Mass | 283.94 |
| IUPAC Name | trans-(1R,2S)-1-(dibromomethyl)-2-methylcyclohexan-1-ol |
| SMILES | C[C@H]1CCCC[C@]1(O)C(Br)Br |
| InChI | InChI=1S/C8H14Br2O/c1-6-4-2-3-5-8(6,11)7(9)10/h6-7,11H,2-5H2,1H3/t6-,8+/m0/s1 |
| InChIKey | VKMLKVAQKIRJHG-POYBYMJQSA-N |
| XLogP | 3.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.01 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|