C8H13Br3O — CID 125486764
cis-(1R,2R)-2-methyl-1-(tribromomethyl)cyclohexan-1-ol (PubChem CID 125486764) has the molecular formula C8H13Br3O and a molecular weight of 364.90 g/mol. Its IUPAC name is cis-(1R,2R)-2-methyl-1-(tribromomethyl)cyclohexan-1-ol.
| Compound Name | cis-(1R,2R)-2-methyl-1-(tribromomethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 125486764 |
| Molecular Formula | C8H13Br3O |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 361.85 |
| IUPAC Name | cis-(1R,2R)-2-methyl-1-(tribromomethyl)cyclohexan-1-ol |
| SMILES | C[C@@H]1CCCC[C@]1(O)C(Br)(Br)Br |
| InChI | InChI=1S/C8H13Br3O/c1-6-4-2-3-5-7(6,12)8(9,10)11/h6,12H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | CUHJSONCIGGRHK-RNFRBKRXSA-N |
| XLogP | 3.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|