C12H17N5O3 — CID 102529666
1-(6-isocyanatohexyl)-3-(6-oxo-1H-pyrimidin-2-yl)urea (PubChem CID 102529666) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 1-(6-isocyanatohexyl)-3-(6-oxo-1H-pyrimidin-2-yl)urea.
| Compound Name | 1-(6-isocyanatohexyl)-3-(6-oxo-1H-pyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 102529666 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 1-(6-isocyanatohexyl)-3-(6-oxo-1H-pyrimidin-2-yl)urea |
| SMILES | O=C=NCCCCCCNC(=O)Nc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C12H17N5O3/c18-9-13-6-3-1-2-4-7-15-12(20)17-11-14-8-5-10(19)16-11/h5,8H,1-4,6-7H2,(H3,14,15,16,17,19,20) |
| InChIKey | BYWPTISTFFUGNA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|