About 7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one
7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one (PubChem CID 10376739) has the molecular formula C12H18N4O
and a molecular weight of 234.30 g/mol. Its IUPAC name is 7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one |
| PubChem CID | 10376739 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one |
| SMILES | CCCCCCn1ccn2c(=O)cc(N)nc12 |
| InChI | InChI=1S/C12H18N4O/c1-2-3-4-5-6-15-7-8-16-11(17)9-10(13)14-12(15)16/h7-9H,2-6,13H2,1H3 |
| InChIKey | RIVLVKKWIIOBKE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 65.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one?
The IUPAC name of 7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one (CID 10376739) is 7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one.
What is the SMILES notation for 7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one?
The canonical SMILES for 7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one is CCCCCCn1ccn2c(=O)cc(N)nc12.
What is the InChIKey of 7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one?
The InChIKey is RIVLVKKWIIOBKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O/c1-2-3-4-5-6-15-7-8-16-11(17)9-10(13)14-12(15)16/h7-9H,2-6,13H2,1H3.
What are the key properties of 7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one?
7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one has a molecular weight of 234.30 g/mol, XLogP of 1.66, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-1-hexylimidazo[1,2-a]pyrimidin-5-one is sourced from PubChem (CID 10376739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).