C11H17N5O — CID 10263477
2-amino-8-hexylimidazo[1,2-a][1,3,5]triazin-4-one (PubChem CID 10263477) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-amino-8-hexylimidazo[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 2-amino-8-hexylimidazo[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 10263477 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-amino-8-hexylimidazo[1,2-a][1,3,5]triazin-4-one |
| SMILES | CCCCCCn1ccn2c(=O)nc(N)nc12 |
| InChI | InChI=1S/C11H17N5O/c1-2-3-4-5-6-15-7-8-16-10(15)13-9(12)14-11(16)17/h7-8H,2-6H2,1H3,(H2,12,14,17) |
| InChIKey | LYOZLAZJDLJDBN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|