C9H10N6O — CID 58603096
2-amino-8-(3-isocyanopropyl)imidazo[1,2-a][1,3,5]triazin-4-one (PubChem CID 58603096) has the molecular formula C9H10N6O and a molecular weight of 218.22 g/mol. Its IUPAC name is 2-amino-8-(3-isocyanopropyl)imidazo[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 2-amino-8-(3-isocyanopropyl)imidazo[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 58603096 |
| Molecular Formula | C9H10N6O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-amino-8-(3-isocyanopropyl)imidazo[1,2-a][1,3,5]triazin-4-one |
| SMILES | [C-]#[N+]CCCn1ccn2c(=O)nc(N)nc12 |
| InChI | InChI=1S/C9H10N6O/c1-11-3-2-4-14-5-6-15-8(14)12-7(10)13-9(15)16/h5-6H,2-4H2,(H2,10,13,16) |
| InChIKey | LNJUPWMJRXDGNU-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|