C7H9N5O — CID 58603113
2-amino-8-ethylimidazo[1,2-a][1,3,5]triazin-4-one (PubChem CID 58603113) has the molecular formula C7H9N5O and a molecular weight of 179.18 g/mol. Its IUPAC name is 2-amino-8-ethylimidazo[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 2-amino-8-ethylimidazo[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 58603113 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2-amino-8-ethylimidazo[1,2-a][1,3,5]triazin-4-one |
| SMILES | CCn1ccn2c(=O)nc(N)nc12 |
| InChI | InChI=1S/C7H9N5O/c1-2-11-3-4-12-6(11)9-5(8)10-7(12)13/h3-4H,2H2,1H3,(H2,8,10,13) |
| InChIKey | HQSOGWYILBYRGD-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |