C10H15N5O — CID 10082230
2-amino-8-pentylimidazo[1,2-a][1,3,5]triazin-4-one (PubChem CID 10082230) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-amino-8-pentylimidazo[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 2-amino-8-pentylimidazo[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 10082230 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 2-amino-8-pentylimidazo[1,2-a][1,3,5]triazin-4-one |
| SMILES | CCCCCn1ccn2c(=O)nc(N)nc12 |
| InChI | InChI=1S/C10H15N5O/c1-2-3-4-5-14-6-7-15-9(14)12-8(11)13-10(15)16/h6-7H,2-5H2,1H3,(H2,11,13,16) |
| InChIKey | MKLVWFIHWURRQA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|