C33H59NO5 — CID 102529848
[(E,1R,2R)-1-cyclohexyl-1-(decanoylamino)-5-ethoxy-5-oxopent-3-en-2-yl] decanoate (PubChem CID 102529848) has the molecular formula C33H59NO5 and a molecular weight of 549.84 g/mol. Its IUPAC name is [(E,1R,2R)-1-cyclohexyl-1-(decanoylamino)-5-ethoxy-5-oxopent-3-en-2-yl] decanoate.
| Compound Name | [(E,1R,2R)-1-cyclohexyl-1-(decanoylamino)-5-ethoxy-5-oxopent-3-en-2-yl] decanoate |
|---|---|
| PubChem CID | 102529848 |
| Molecular Formula | C33H59NO5 |
| Molecular Weight | 549.84 g/mol |
| Exact Mass | 549.44 |
| IUPAC Name | [(E,1R,2R)-1-cyclohexyl-1-(decanoylamino)-5-ethoxy-5-oxopent-3-en-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)N[C@H](C1CCCCC1)[C@@H](/C=C/C(=O)OCC)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C33H59NO5/c1-4-7-9-11-13-15-20-24-30(35)34-33(28-22-18-17-19-23-28)29(26-27-31(36)38-6-3)39-32(37)25-21-16-14-12-10-8-5-2/h26-29,33H,4-25H2,1-3H3,(H,34,35)/b27-26+/t29-,33-/m1/s1 |
| InChIKey | LOALPTRZYBBUSV-RMDMHQQESA-N |
| XLogP | 8.36 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.84 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|