C20H31NO4 — CID 135024501
[(Z,2S)-5-[[(2R,5S,6S)-2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate (PubChem CID 135024501) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is [(Z,2S)-5-[[(2R,5S,6S)-2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate.
| Compound Name | [(Z,2S)-5-[[(2R,5S,6S)-2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 135024501 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | [(Z,2S)-5-[[(2R,5S,6S)-2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
| SMILES | C=C/C(C)=C/C[C@@H]1O[C@H](C)C(NC(=O)/C=C\[C@H](C)OC(C)=O)C[C@@H]1C |
| InChI | InChI=1S/C20H31NO4/c1-7-13(2)8-10-19-14(3)12-18(16(5)25-19)21-20(23)11-9-15(4)24-17(6)22/h7-9,11,14-16,18-19H,1,10,12H2,2-6H3,(H,21,23)/b11-9-,13-8+/t14-,15-,16+,18?,19-/m0/s1 |
| InChIKey | PRDLVQYAEVFPDA-ZROUCHQLSA-N |
| XLogP | 3.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|