C13H14N2O3 — CID 102529962
ethyl 3-(furan-2-yl)-1-prop-2-enylpyrazole-5-carboxylate (PubChem CID 102529962) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is ethyl 3-(furan-2-yl)-1-prop-2-enylpyrazole-5-carboxylate.
| Compound Name | ethyl 3-(furan-2-yl)-1-prop-2-enylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 102529962 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | ethyl 3-(furan-2-yl)-1-prop-2-enylpyrazole-5-carboxylate |
| SMILES | C=CCn1nc(-c2ccco2)cc1C(=O)OCC |
| InChI | InChI=1S/C13H14N2O3/c1-3-7-15-11(13(16)17-4-2)9-10(14-15)12-6-5-8-18-12/h3,5-6,8-9H,1,4,7H2,2H3 |
| InChIKey | RJSQTSIIEVUFSR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|