C16H28O5 — CID 102531992
(3R,4S,5S)-4-hydroxy-5-[(E)-6-(methoxymethoxy)-2,4-dimethylhex-4-enyl]-3,5-dimethyloxolan-2-one (PubChem CID 102531992) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3R,4S,5S)-4-hydroxy-5-[(E)-6-(methoxymethoxy)-2,4-dimethylhex-4-enyl]-3,5-dimethyloxolan-2-one.
| Compound Name | (3R,4S,5S)-4-hydroxy-5-[(E)-6-(methoxymethoxy)-2,4-dimethylhex-4-enyl]-3,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 102531992 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (3R,4S,5S)-4-hydroxy-5-[(E)-6-(methoxymethoxy)-2,4-dimethylhex-4-enyl]-3,5-dimethyloxolan-2-one |
| SMILES | COCOC/C=C(\C)CC(C)C[C@]1(C)OC(=O)[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C16H28O5/c1-11(6-7-20-10-19-5)8-12(2)9-16(4)14(17)13(3)15(18)21-16/h6,12-14,17H,7-10H2,1-5H3/b11-6+/t12?,13-,14+,16+/m1/s1 |
| InChIKey | JMXXKRZPBRCFRI-OBCLCTEXSA-N |
| XLogP | 2.28 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|